Difference between revisions of "PWY-6619"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SPERMIDINE SPERMIDINE] == * common-name: ** spermidine * smiles: ** c([n+])cc[n+]cccc[n+] * inc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRYPTAMINE TRYPTAMINE] == * common-name: ** tryptamine * smiles: ** c([n+])cc1(=cnc2(c=cc=cc1=2...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRYPTAMINE TRYPTAMINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** tryptamine |
* smiles: | * smiles: | ||
| − | ** c([n+])cc | + | ** c([n+])cc1(=cnc2(c=cc=cc1=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** apjydqyyacxcrm-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 161.226 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-1401]] | |
| − | + | * [[STRICTOSIDINE-SYNTHASE-RXN]] | |
| − | * [[RXN- | ||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=tryptamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=apjydqyyacxcrm-uhfffaoysa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=161.226}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite TRYPTAMINE
- common-name:
- tryptamine
- smiles:
- c([n+])cc1(=cnc2(c=cc=cc1=2))
- inchi-key:
- apjydqyyacxcrm-uhfffaoysa-o
- molecular-weight:
- 161.226
