Difference between revisions of "PWY-6627"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDMETA-13652 CPDMETA-13652] == * common-name: ** raucaffrinoline * smiles: ** cc3(n5(c2(c1(=nc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9973 CPD-9973] == * common-name: ** an [eif5a-precursor]-deoxyhypusine == Reaction(s) known...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDMETA-13652 CPDMETA-13652] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9973 CPD-9973] ==
 
* common-name:
 
* common-name:
** raucaffrinoline
+
** an [eif5a-precursor]-deoxyhypusine
* smiles:
 
** cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(co)3)c(c4)5)oc(=o)c))6)))))
 
* inchi-key:
 
** ximpcxfldskalh-vqhwpedhsa-n
 
* molecular-weight:
 
** 352.432
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[DEOXYHYPUSINE-MONOOXYGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12673]]
+
* [[2.5.1.46-RXN]]
 +
* [[RXN-13417]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=raucaffrinoline}}
+
{{#set: common-name=an [eif5a-precursor]-deoxyhypusine}}
{{#set: inchi-key=inchikey=ximpcxfldskalh-vqhwpedhsa-n}}
 
{{#set: molecular-weight=352.432}}
 

Revision as of 14:18, 26 August 2019

Metabolite CPD-9973

  • common-name:
    • an [eif5a-precursor]-deoxyhypusine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an [eif5a-precursor]-deoxyhypusine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.