Difference between revisions of "PWY-6637"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2K-ADIPATE 2K-ADIPATE] ==
+== Pathway PWY-6637 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 2-oxoadipate
+** sulfolactate degradation ii
-* smiles:
+== Reaction(s) found ==
-** c(cc(=o)c(=o)[o-])cc(=o)[o-]
+* [[PHOSACETYLTRANS-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** fgsbnbbhozhubo-uhfffaoysa-l
+* [NoneR231-RXN R231-RXN]
-* molecular-weight:
+* [NoneRXN-11738 RXN-11738]
-** 158.11
+* [NoneRXN-2364 RXN-2364]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2}}
-* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
+{{#set: common-name=sulfolactate degradation ii}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.25}}
-{{#set: common-name=2-oxoadipate}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=fgsbnbbhozhubo-uhfffaoysa-l}}
-{{#set: molecular-weight=158.11}}