Difference between revisions of "PWY-6644"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE 2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE] ==
+== Pathway PWY-6644 ==
+* taxonomic-range:
+** tax-33090
+** tax-2
 * common-name:
-** 2-carboxy-d-arabinitol 1-phosphate
+** fluoroacetate and fluorothreonine biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(c(c(c(cop([o-])([o-])=o)(c([o-])=o)o)o)o)o
+* [[RXN-11743]]
-* inchi-key:
+== Reaction(s) not found ==
-** ujtmirnfexkgms-uhfffaoysa-k
+* [NoneRXN-11746 RXN-11746]
-* molecular-weight:
+* [None2.5.1.63-RXN 2.5.1.63-RXN]
-** 273.113
+* [NoneRXN-11745 RXN-11745]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-11747 RXN-11747]
-* [[2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE-RXN]]
+* [NoneRXN-11744 RXN-11744]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-2|tax-33090}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=fluoroacetate and fluorothreonine biosynthesis}}
-{{#set: common-name=2-carboxy-d-arabinitol 1-phosphate}}
+{{#set: nb reaction found=1}}
-{{#set: inchi-key=inchikey=ujtmirnfexkgms-uhfffaoysa-k}}
+{{#set: completion rate=0.17}}
-{{#set: molecular-weight=273.113}}
+{{#set: nb total reaction=6}}