Difference between revisions of "PWY-6649"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-CHLORO-24-DINITROBENZENE 1-CHLORO-24-DINITROBENZENE] ==
+== Pathway PWY-6649 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 1-chloro-2,4-dinitrobenzene
+** glycolate and glyoxylate degradation iii
-* smiles:
+== Reaction(s) found ==
-** c1(c=c(cl)c(=cc=1[n+]([o-])=o)[n+]([o-])=o)
+* [[GLYCOLATEDEHYDRO-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** vyzahlcbvhpddf-uhfffaoysa-n
+* [NoneRXN-11769 RXN-11769]
-* molecular-weight:
+* [None4.3.1.20-RXN 4.3.1.20-RXN]
-** 202.554
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=glycolate and glyoxylate degradation iii}}
-* [[GST-RXN]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.33}}
-* [[GST-RXN]]
+{{#set: nb total reaction=3}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=1-chloro-2,4-dinitrobenzene}}
-{{#set: inchi-key=inchikey=vyzahlcbvhpddf-uhfffaoysa-n}}
-{{#set: molecular-weight=202.554}}