Difference between revisions of "PWY-6649"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glycoprotein-L-serine-or-L-threonine Glycoprotein-L-serine-or-L-threonine] == * common-name: **...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-CHLORO-24-DINITROBENZENE 1-CHLORO-24-DINITROBENZENE] == * common-name: ** 1-chloro-2,4-dinitr...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-CHLORO-24-DINITROBENZENE 1-CHLORO-24-DINITROBENZENE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-chloro-2,4-dinitrobenzene |
| + | * smiles: | ||
| + | ** c1(c=c(cl)c(=cc=1[n+]([o-])=o)[n+]([o-])=o) | ||
| + | * inchi-key: | ||
| + | ** vyzahlcbvhpddf-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 202.554 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[GST-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[GST-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-chloro-2,4-dinitrobenzene}} |
| + | {{#set: inchi-key=inchikey=vyzahlcbvhpddf-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=202.554}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite 1-CHLORO-24-DINITROBENZENE
- common-name:
- 1-chloro-2,4-dinitrobenzene
- smiles:
- c1(c=c(cl)c(=cc=1[n+]([o-])=o)[n+]([o-])=o)
- inchi-key:
- vyzahlcbvhpddf-uhfffaoysa-n
- molecular-weight:
- 202.554
