Difference between revisions of "PWY-6659"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18489 CPD-18489] == * common-name: ** (3r)-hydroxy-tetracosatetraenoyl-coa * smiles: ** ccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-2Fe-2S-Ferredoxins Reduced-2Fe-2S-Ferredoxins] == * common-name: ** a reduced [2fe-2s]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18489 CPD-18489] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-2Fe-2S-Ferredoxins Reduced-2Fe-2S-Ferredoxins] ==
 
* common-name:
 
* common-name:
** (3r)-hydroxy-tetracosatetraenoyl-coa
+
** a reduced [2fe-2s] ferredoxin
* smiles:
 
** cccccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** dmysjgjjptxmaw-jjkiljmssa-j
 
* molecular-weight:
 
** 1122.065
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17110]]
+
* [[2.8.1.6-RXN]]
 +
* [[RXN-11586]]
 +
* [[RXN-14950]]
 +
* [[RXN-14957]]
 +
* [[RXN-14959]]
 +
* [[RXN-17472]]
 +
* [[RXN0-949]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17109]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-hydroxy-tetracosatetraenoyl-coa}}
+
{{#set: common-name=a reduced [2fe-2s] ferredoxin}}
{{#set: inchi-key=inchikey=dmysjgjjptxmaw-jjkiljmssa-j}}
 
{{#set: molecular-weight=1122.065}}
 

Revision as of 14:18, 26 August 2019

Metabolite Reduced-2Fe-2S-Ferredoxins

  • common-name:
    • a reduced [2fe-2s] ferredoxin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a reduced [2fe-2s] ferredoxin" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.