Difference between revisions of "PWY-6660"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TAGATOSE-1-6-DIPHOSPHATE TAGATOSE-1-6-DIPHOSPHATE] ==
+== Pathway PWY-6660 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** d-tagatofuranose 1,6-bisphosphate
+** 2-heptyl-3-hydroxy-4(1h)-quinolone biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=o)c(o)c1o)
+* [[ANTHRANSYN-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** rnbgygvwrkecfj-oexcpvawsa-j
+* [NoneRXN-17709 RXN-17709]
-* molecular-weight:
+* [NoneAMINOBENZCOALIG-RXN AMINOBENZCOALIG-RXN]
-** 336.085
+* [NoneRXN-11849 RXN-11849]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-17703 RXN-17703]
-* [[TAGAALDOL-RXN]]
+* [NoneRXN-17705 RXN-17705]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-17707 RXN-17707]
-* [[TAGAKIN-RXN]]
+* [NoneRXN-17702 RXN-17702]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-17708 RXN-17708]
-{{#set: common-name=d-tagatofuranose 1,6-bisphosphate}}
+{{#set: taxonomic-range=tax-2}}
-{{#set: inchi-key=inchikey=rnbgygvwrkecfj-oexcpvawsa-j}}
+{{#set: common-name=2-heptyl-3-hydroxy-4(1h)-quinolone biosynthesis}}
-{{#set: molecular-weight=336.085}}
+{{#set: nb reaction found=1}}
+{{#set: completion rate=0.12}}
+{{#set: nb total reaction=8}}