Difference between revisions of "PWY-6660"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TAGATOSE-1-6-DIPHOSPHATE TAGATOSE-1-6-DIPHOSPHATE] == * common-name: ** d-tagatofuranose 1,6-bi...")
(Created page with "Category:pathway == Pathway PWY-6660 == * taxonomic-range: ** tax-2 * common-name: ** 2-heptyl-3-hydroxy-4(1h)-quinolone biosynthesis == Reaction(s) found == * ANTHRANSY...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TAGATOSE-1-6-DIPHOSPHATE TAGATOSE-1-6-DIPHOSPHATE] ==
+
== Pathway PWY-6660 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** d-tagatofuranose 1,6-bisphosphate
+
** 2-heptyl-3-hydroxy-4(1h)-quinolone biosynthesis
* smiles:
+
== Reaction(s) found ==
** c(op([o-])(=o)[o-])c1(oc(o)(cop([o-])([o-])=o)c(o)c1o)
+
* [[ANTHRANSYN-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** rnbgygvwrkecfj-oexcpvawsa-j
+
* [NoneRXN-17709 RXN-17709]
* molecular-weight:
+
* [NoneRXN-17705 RXN-17705]
** 336.085
+
* [NoneRXN-17702 RXN-17702]
== Reaction(s) known to consume the compound ==
+
* [NoneAMINOBENZCOALIG-RXN AMINOBENZCOALIG-RXN]
* [[TAGAALDOL-RXN]]
+
* [NoneRXN-17703 RXN-17703]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-11849 RXN-11849]
* [[TAGAKIN-RXN]]
+
* [NoneRXN-17707 RXN-17707]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN-17708 RXN-17708]
{{#set: common-name=d-tagatofuranose 1,6-bisphosphate}}
+
{{#set: taxonomic-range=tax-2}}
{{#set: inchi-key=inchikey=rnbgygvwrkecfj-oexcpvawsa-j}}
+
{{#set: common-name=2-heptyl-3-hydroxy-4(1h)-quinolone biosynthesis}}
{{#set: molecular-weight=336.085}}
+
{{#set: nb reaction found=1}}
 +
{{#set: completion rate=0.12}}
 +
{{#set: nb total reaction=8}}

Revision as of 20:15, 18 December 2020

Pathway PWY-6660

  • taxonomic-range:
    • tax-2
  • common-name:
    • 2-heptyl-3-hydroxy-4(1h)-quinolone biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-17709 RXN-17709]
  • [NoneRXN-17705 RXN-17705]
  • [NoneRXN-17702 RXN-17702]
  • [NoneAMINOBENZCOALIG-RXN AMINOBENZCOALIG-RXN]
  • [NoneRXN-17703 RXN-17703]
  • [NoneRXN-11849 RXN-11849]
  • [NoneRXN-17707 RXN-17707]
  • [NoneRXN-17708 RXN-17708]