Difference between revisions of "PWY-6672"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ 2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ] == * common-na...")
 
(Created page with "Category:pathway == Pathway PWY-6672 == * taxonomic-range: ** tax-2 * common-name: ** cis-genanyl-coa degradation == Reaction(s) found == * ACETATE--COA-LIGASE-RXN * [...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ 2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ] ==
+
== Pathway PWY-6672 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** 6-methoxy-3-methyl-2-all-trans-hexaprenyl-1,4-benzoquinol
+
** cis-genanyl-coa degradation
* smiles:
+
== Reaction(s) found ==
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c
+
* [[ACETATE--COA-LIGASE-RXN]]
* inchi-key:
+
* [[RXN-11917]]
** atqqulxelmejix-nsuijkaqsa-n
+
* [[RXN-11919]]
* molecular-weight:
+
* [[RXN-11921]]
** 562.874
+
== Reaction(s) not found ==
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-11918 RXN-11918]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-11920 RXN-11920]
* [[RXN3O-54]]
+
* [NoneGERANOYL-COA-CARBOXYLASE-RXN GERANOYL-COA-CARBOXYLASE-RXN]
== Reaction(s) of unknown directionality ==
+
* [NoneISOHEXENYLGLUTACONYL-COA-HYDRATASE-RXN ISOHEXENYLGLUTACONYL-COA-HYDRATASE-RXN]
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-hexaprenyl-1,4-benzoquinol}}
+
* [None4.1.3.26-RXN 4.1.3.26-RXN]
{{#set: inchi-key=inchikey=atqqulxelmejix-nsuijkaqsa-n}}
+
{{#set: taxonomic-range=tax-2}}
{{#set: molecular-weight=562.874}}
+
{{#set: common-name=cis-genanyl-coa degradation}}
 +
{{#set: nb reaction found=4}}
 +
{{#set: completion rate=0.44}}
 +
{{#set: nb total reaction=9}}

Latest revision as of 10:59, 18 March 2021

Pathway PWY-6672

  • taxonomic-range:
    • tax-2
  • common-name:
    • cis-genanyl-coa degradation

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-11918 RXN-11918]
  • [NoneRXN-11920 RXN-11920]
  • [NoneGERANOYL-COA-CARBOXYLASE-RXN GERANOYL-COA-CARBOXYLASE-RXN]
  • [NoneISOHEXENYLGLUTACONYL-COA-HYDRATASE-RXN ISOHEXENYLGLUTACONYL-COA-HYDRATASE-RXN]
  • [None4.1.3.26-RXN 4.1.3.26-RXN]