Difference between revisions of "PWY-6672"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7214 CPD-7214] == * common-name: ** (2s)-dihydrotricetin * smiles: ** c3(c(c2(oc1(c=c(c=c(c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dermatan-NAcGal-46-disulfates Dermatan-NAcGal-46-disulfates] == * common-name: ** [dermatan]-4,...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7214 CPD-7214] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dermatan-NAcGal-46-disulfates Dermatan-NAcGal-46-disulfates] ==
 
* common-name:
 
* common-name:
** (2s)-dihydrotricetin
+
** [dermatan]-4,6-di-o-sulfo-n-acetyl-d-galactosamine
* smiles:
 
** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o)
 
* inchi-key:
 
** usqxpewrywrrjd-lbprgkrzsa-m
 
* molecular-weight:
 
** 303.248
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7922]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7953]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2s)-dihydrotricetin}}
+
{{#set: common-name=[dermatan]-4,6-di-o-sulfo-n-acetyl-d-galactosamine}}
{{#set: inchi-key=inchikey=usqxpewrywrrjd-lbprgkrzsa-m}}
 
{{#set: molecular-weight=303.248}}
 

Revision as of 09:22, 27 August 2019

Metabolite Dermatan-NAcGal-46-disulfates

  • common-name:
    • [dermatan]-4,6-di-o-sulfo-n-acetyl-d-galactosamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "dermatan]-4,6-di-o-sulfo-n-acetyl-d-galactosamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.