Difference between revisions of "PWY-6681"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3705 CPD-3705] == * common-name: ** adenosine 2'-monophosphate * smiles: ** c(c3(c(c(c(n2(c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-MERCAPTO-PYRUVATE 3-MERCAPTO-PYRUVATE] == * common-name: ** 3-mercaptopyruvate * smiles: ** c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3705 CPD-3705] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-MERCAPTO-PYRUVATE 3-MERCAPTO-PYRUVATE] ==
 
* common-name:
 
* common-name:
** adenosine 2'-monophosphate
+
** 3-mercaptopyruvate
 
* smiles:
 
* smiles:
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)op(=o)([o-])[o-])o))o
+
** c(c(c(=o)[o-])=o)s
 
* inchi-key:
 
* inchi-key:
** qdfhpfsbqfllsw-kqynxxcusa-l
+
** ojolfaigoxzbci-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 345.208
+
** 119.115
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
 +
* [[MERCAPYSTRANS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12057]]
+
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adenosine 2'-monophosphate}}
+
{{#set: common-name=3-mercaptopyruvate}}
{{#set: inchi-key=inchikey=qdfhpfsbqfllsw-kqynxxcusa-l}}
+
{{#set: inchi-key=inchikey=ojolfaigoxzbci-uhfffaoysa-m}}
{{#set: molecular-weight=345.208}}
+
{{#set: molecular-weight=119.115}}

Revision as of 09:22, 27 August 2019

Metabolite 3-MERCAPTO-PYRUVATE

  • common-name:
    • 3-mercaptopyruvate
  • smiles:
    • c(c(c(=o)[o-])=o)s
  • inchi-key:
    • ojolfaigoxzbci-uhfffaoysa-m
  • molecular-weight:
    • 119.115

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality