Difference between revisions of "PWY-6696"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9955 CPD-9955] == * common-name: ** ubiquinol-7 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=...")
(Created page with "Category:pathway == Pathway PWY-7800 == * taxonomic-range: ** tax-2759 * common-name: ** ac/n-end rule pathway == Reaction(s) found == * RXN-17873 * RXN-17874 * ...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9955 CPD-9955] ==
+
== Pathway PWY-7800 ==
 +
* taxonomic-range:
 +
** tax-2759
 
* common-name:
 
* common-name:
** ubiquinol-7
+
** ac/n-end rule pathway
* smiles:
+
== Reaction(s) found ==
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
+
* [[RXN-17873]]
* inchi-key:
+
* [[RXN-17874]]
** pfiusppkanbdhq-rjyqsxaysa-n
+
* [[RXN-17875]]
* molecular-weight:
+
* [[RXN-17876]]
** 661.019
+
* [[RXN-17877]]
== Reaction(s) known to consume the compound ==
+
* [[RXN-17878]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) not found ==
* [[RXN-9229]]
+
* [NoneRXN-17854 RXN-17854]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN-17863 RXN-17863]
{{#set: common-name=ubiquinol-7}}
+
* [NoneRXN-17856 RXN-17856]
{{#set: inchi-key=inchikey=pfiusppkanbdhq-rjyqsxaysa-n}}
+
* [NoneRXN-17859 RXN-17859]
{{#set: molecular-weight=661.019}}
+
* [NoneRXN-17860 RXN-17860]
 +
* [NoneRXN-17861 RXN-17861]
 +
* [NoneRXN-17855 RXN-17855]
 +
* [NoneRXN-17862 RXN-17862]
 +
* [NoneRXN-17864 RXN-17864]
 +
* [NoneRXN-17851 RXN-17851]
 +
* [NoneRXN-17857 RXN-17857]
 +
* [NoneRXN-17852 RXN-17852]
 +
* [NoneRXN-17850 RXN-17850]
 +
* [NoneRXN-17858 RXN-17858]
 +
* [NoneRXN-17853 RXN-17853]
 +
{{#set: taxonomic-range=tax-2759}}
 +
{{#set: common-name=ac/n-end rule pathway}}
 +
{{#set: nb reaction found=6}}
 +
{{#set: completion rate=0.29}}
 +
{{#set: nb total reaction=21}}

Revision as of 20:16, 18 December 2020

Pathway PWY-7800

  • taxonomic-range:
    • tax-2759
  • common-name:
    • ac/n-end rule pathway

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-17854 RXN-17854]
  • [NoneRXN-17863 RXN-17863]
  • [NoneRXN-17856 RXN-17856]
  • [NoneRXN-17859 RXN-17859]
  • [NoneRXN-17860 RXN-17860]
  • [NoneRXN-17861 RXN-17861]
  • [NoneRXN-17855 RXN-17855]
  • [NoneRXN-17862 RXN-17862]
  • [NoneRXN-17864 RXN-17864]
  • [NoneRXN-17851 RXN-17851]
  • [NoneRXN-17857 RXN-17857]
  • [NoneRXN-17852 RXN-17852]
  • [NoneRXN-17850 RXN-17850]
  • [NoneRXN-17858 RXN-17858]
  • [NoneRXN-17853 RXN-17853]