Difference between revisions of "PWY-6708"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] == * common-name: ** hydroxybupropion * smiles: ** cc([n+]c(c)(c)co)c(=o)c1(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11602 CPD-11602] == * common-name: ** ergosterol 3-o-β-d-glucoside * smiles: ** cc(c)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11602 CPD-11602] ==
 
* common-name:
 
* common-name:
** hydroxybupropion
+
** ergosterol 3-o-β-d-glucoside
 
* smiles:
 
* smiles:
** cc([n+]c(c)(c)co)c(=o)c1(c=cc=c(cl)c=1)
+
** cc(c)c(c)c=cc(c)[ch]4(cc[ch]5(c3(=cc=c2(cc(oc1(oc(co)c(o)c(o)c(o)1))ccc(c)2[ch]3ccc(c)45))))
 
* inchi-key:
 
* inchi-key:
** akoaevosdhivfx-uhfffaoysa-o
+
** mkzpngbjjjzjmi-vnwfyegesa-n
 
* molecular-weight:
 
* molecular-weight:
** 256.752
+
** 558.797
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-181]]
+
* [[RXN-16975]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=hydroxybupropion}}
+
{{#set: common-name=ergosterol 3-o-β-d-glucoside}}
{{#set: inchi-key=inchikey=akoaevosdhivfx-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=mkzpngbjjjzjmi-vnwfyegesa-n}}
{{#set: molecular-weight=256.752}}
+
{{#set: molecular-weight=558.797}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-11602

  • common-name:
    • ergosterol 3-o-β-d-glucoside
  • smiles:
    • cc(c)c(c)c=cc(c)[ch]4(cc[ch]5(c3(=cc=c2(cc(oc1(oc(co)c(o)c(o)c(o)1))ccc(c)2[ch]3ccc(c)45))))
  • inchi-key:
    • mkzpngbjjjzjmi-vnwfyegesa-n
  • molecular-weight:
    • 558.797

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality