Difference between revisions of "PWY-6722"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-365 CPD-365] ==
+== Pathway PWY-6722 ==
+* taxonomic-range:
+** tax-1883
 * common-name:
-** 1-keto-d-chiro-inositol
+** candicidin biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c1(o)(c(o)c(o)c(=o)c(o)c(o)1)
+* [[RXN0-5055]]
-* inchi-key:
+== Reaction(s) not found ==
-** vyegbdhsghxogt-qfycrykcsa-n
+* [NoneRXN-15954 RXN-15954]
-* molecular-weight:
+* [NoneRXN-15975 RXN-15975]
-** 178.141
+* [NoneRXN-12161 RXN-12161]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-15971 RXN-15971]
-* [[RXN-14148]]
+* [NoneRXN-12162 RXN-12162]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-1883}}
-* [[RXN-14148]]
+{{#set: common-name=candicidin biosynthesis}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=1}}
-{{#set: common-name=1-keto-d-chiro-inositol}}
+{{#set: completion rate=0.17}}
-{{#set: inchi-key=inchikey=vyegbdhsghxogt-qfycrykcsa-n}}
+{{#set: nb total reaction=6}}
-{{#set: molecular-weight=178.141}}