Difference between revisions of "PWY-6728"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] == * common-name: ** 2-phospho-d-glycerate * smiles: ** c(=o)([o-])c(op(=o)([o-])[o-...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12116 CPD-12116] == * common-name: ** demethylmenaquinol-6 * smiles: ** cc(=cccc(c)=cccc(c)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12116 CPD-12116] == |
* common-name: | * common-name: | ||
| − | ** | + | ** demethylmenaquinol-6 |
* smiles: | * smiles: | ||
| − | ** c(= | + | ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ufaxpzazhzpelj-rotsudqpsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 568.881 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-9220]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=demethylmenaquinol-6}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ufaxpzazhzpelj-rotsudqpsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=568.881}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-12116
- common-name:
- demethylmenaquinol-6
- smiles:
- cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
- inchi-key:
- ufaxpzazhzpelj-rotsudqpsa-n
- molecular-weight:
- 568.881
