Difference between revisions of "PWY-6728"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12116 CPD-12116] == * common-name: ** demethylmenaquinol-6 * smiles: ** cc(=cccc(c)=cccc(c)...")
(Created page with "Category:pathway == Pathway PWY-6454 == * taxonomic-range: ** tax-2 * common-name: ** vancomycin resistance i == Reaction(s) found == * DLACTDEHYDROGNAD-RXN == Reactio...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12116 CPD-12116] ==
+
== Pathway PWY-6454 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** demethylmenaquinol-6
+
** vancomycin resistance i
* smiles:
+
== Reaction(s) found ==
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
+
* [[DLACTDEHYDROGNAD-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** ufaxpzazhzpelj-rotsudqpsa-n
+
* [None3.4.13.22-RXN 3.4.13.22-RXN]
* molecular-weight:
+
* [NoneRXN-11298 RXN-11298]
** 568.881
+
{{#set: taxonomic-range=tax-2}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=vancomycin resistance i}}
* [[RXN-9220]]
+
{{#set: nb reaction found=1}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=0.33}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=3}}
{{#set: common-name=demethylmenaquinol-6}}
 
{{#set: inchi-key=inchikey=ufaxpzazhzpelj-rotsudqpsa-n}}
 
{{#set: molecular-weight=568.881}}
 

Revision as of 20:18, 18 December 2020

Pathway PWY-6454

  • taxonomic-range:
    • tax-2
  • common-name:
    • vancomycin resistance i

Reaction(s) found

Reaction(s) not found

  • [None3.4.13.22-RXN 3.4.13.22-RXN]
  • [NoneRXN-11298 RXN-11298]