Difference between revisions of "PWY-6728"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-Amino-Acids N-terminal-Amino-Acids] == * common-name: ** an n-terminal amino acyl-[p...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] == * common-name: ** 2-phospho-d-glycerate * smiles: ** c(=o)([o-])c(op(=o)([o-])[o-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-phospho-d-glycerate |
| + | * smiles: | ||
| + | ** c(=o)([o-])c(op(=o)([o-])[o-])co | ||
| + | * inchi-key: | ||
| + | ** gxiurptvhjpjlf-uwtatzphsa-k | ||
| + | * molecular-weight: | ||
| + | ** 183.034 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[2PGADEHYDRAT-RXN]] |
| − | * [[RXN- | + | * [[3PGAREARR-RXN]] |
| + | * [[RXN-15510]] | ||
| + | * [[RXN-15513]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[2PGADEHYDRAT-RXN]] |
| + | * [[3PGAREARR-RXN]] | ||
| + | * [[RXN-15510]] | ||
| + | * [[RXN-15513]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-phospho-d-glycerate}} |
| + | {{#set: inchi-key=inchikey=gxiurptvhjpjlf-uwtatzphsa-k}} | ||
| + | {{#set: molecular-weight=183.034}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite 2-PG
- common-name:
- 2-phospho-d-glycerate
- smiles:
- c(=o)([o-])c(op(=o)([o-])[o-])co
- inchi-key:
- gxiurptvhjpjlf-uwtatzphsa-k
- molecular-weight:
- 183.034
