Difference between revisions of "PWY-6731"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15657 CPD-15657] == * common-name: ** (3r)-hydroxy-undecanoyl-coa * smiles: ** ccccccccc(o)...")
(Created page with "Category:pathway == Pathway PWY-6731 == * taxonomic-range: ** tax-2157 * common-name: ** starch degradation iii == Reaction(s) found == * PHOSPHOGLUCMUT-RXN * RXN-12...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15657 CPD-15657] ==
+
== Pathway PWY-6731 ==
 +
* taxonomic-range:
 +
** tax-2157
 
* common-name:
 
* common-name:
** (3r)-hydroxy-undecanoyl-coa
+
** starch degradation iii
* smiles:
+
== Reaction(s) found ==
** ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
* [[PHOSPHOGLUCMUT-RXN]]
* inchi-key:
+
* [[RXN-12171]]
** jiogxinzsoqege-mawalykisa-j
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneCYCLOMALTODEXTRINASE-RXN CYCLOMALTODEXTRINASE-RXN]
** 947.78
+
* [NoneRXN-12181 RXN-12181]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-2157}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=starch degradation iii}}
* [[RXN-14778]]
+
{{#set: nb reaction found=2}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.5}}
{{#set: common-name=(3r)-hydroxy-undecanoyl-coa}}
+
{{#set: nb total reaction=4}}
{{#set: inchi-key=inchikey=jiogxinzsoqege-mawalykisa-j}}
 
{{#set: molecular-weight=947.78}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-6731

  • taxonomic-range:
    • tax-2157
  • common-name:
    • starch degradation iii

Reaction(s) found

Reaction(s) not found

  • [NoneCYCLOMALTODEXTRINASE-RXN CYCLOMALTODEXTRINASE-RXN]
  • [NoneRXN-12181 RXN-12181]