Difference between revisions of "PWY-6736"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-465 CPD-465] ==
+== Pathway PWY-6736 ==
+* taxonomic-range:
+** tax-3700
 * common-name:
-** presqualene diphosphate
+** sulfur volatiles biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)c)c1cop(op([o-])([o-])=o)([o-])=o))c)c)c
+* [[THIOL-S-METHYLTRANSFERASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** atzkauggnmsccy-qlydttawsa-k
+* [NoneRXN-12189 RXN-12189]
-* molecular-weight:
+{{#set: taxonomic-range=tax-3700}}
-** 583.66
+{{#set: common-name=sulfur volatiles biosynthesis}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-13724]]
+{{#set: completion rate=0.5}}
-* [[RXN66-281]]
+{{#set: nb total reaction=2}}
-== Reaction(s) known to produce the compound ==
-* [[RXN-12263]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=presqualene diphosphate}}
-{{#set: inchi-key=inchikey=atzkauggnmsccy-qlydttawsa-k}}
-{{#set: molecular-weight=583.66}}