Difference between revisions of "PWY-6737"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ALPHA-AMINO-EPSILON-KETO-PIMELATE L-ALPHA-AMINO-EPSILON-KETO-PIMELATE] == * common-name: ** l...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-adrenergic-receptors-P Beta-adrenergic-receptors-P] == * common-name: ** a phosphorylated...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ALPHA-AMINO-EPSILON-KETO-PIMELATE L-ALPHA-AMINO-EPSILON-KETO-PIMELATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-adrenergic-receptors-P Beta-adrenergic-receptors-P] ==
 
* common-name:
 
* common-name:
** l-α-amino-ε-keto-pimelate
+
** a phosphorylated β-adrenergic receptor
* smiles:
 
** c([o-])(=o)c(cccc(c([o-])=o)=o)[n+]
 
* inchi-key:
 
** ukcsfklwnhubdy-bypyzucnsa-m
 
* molecular-weight:
 
** 188.16
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
+
* [[2.7.11.15-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
+
* [[2.7.11.15-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-α-amino-ε-keto-pimelate}}
+
{{#set: common-name=a phosphorylated β-adrenergic receptor}}
{{#set: inchi-key=inchikey=ukcsfklwnhubdy-bypyzucnsa-m}}
 
{{#set: molecular-weight=188.16}}
 

Revision as of 09:22, 27 August 2019

Metabolite Beta-adrenergic-receptors-P

  • common-name:
    • a phosphorylated β-adrenergic receptor

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality