Difference between revisions of "PWY-6737"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ALPHA-AMINO-EPSILON-KETO-PIMELATE L-ALPHA-AMINO-EPSILON-KETO-PIMELATE] ==
+== Pathway PWY-6737 ==
+* taxonomic-range:
+** tax-2157
 * common-name:
-** l-&alpha;-amino-&epsilon;-keto-pimelate
+** starch degradation v
-* smiles:
+== Reaction(s) found ==
-** c([o-])(=o)c(cccc(c([o-])=o)=o)[n+]
+* [[PHOSPHOGLUCMUT-RXN]]
-* inchi-key:
+* [[RXN-12171]]
-** ukcsfklwnhubdy-bypyzucnsa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-12193 RXN-12193]
-** 188.16
+* [NoneRXN-12190 RXN-12190]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2157}}
-* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
+{{#set: common-name=starch degradation v}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=2}}
-* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
+{{#set: completion rate=0.5}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=4}}
-{{#set: common-name=l-&alpha;-amino-&epsilon;-keto-pimelate}}
-{{#set: inchi-key=inchikey=ukcsfklwnhubdy-bypyzucnsa-m}}
-{{#set: molecular-weight=188.16}}