Difference between revisions of "PWY-6748"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1718 CPD0-1718] ==
+== Pathway PWY-6748 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 7,8-dihydropterin
+** nitrate reduction vii (denitrification)
-* smiles:
+== Reaction(s) found ==
-** c1(=nc2(=c(nc1)n=c(n)nc(=o)2))
+* [[NITRITE-REDUCTASE-CYTOCHROME-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** pxzwkvixskscfr-uhfffaoysa-n
+* [NoneRXN-12129 RXN-12129]
-* molecular-weight:
+* [NoneTRANS-RXN0-239 TRANS-RXN0-239]
-** 165.154
+* [NoneRXN-12130 RXN-12130]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-11236 RXN-11236]
-* [[RXN-15261]]
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=nitrate reduction vii (denitrification)}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=1}}
-{{#set: common-name=7,8-dihydropterin}}
+{{#set: completion rate=0.2}}
-{{#set: inchi-key=inchikey=pxzwkvixskscfr-uhfffaoysa-n}}
+{{#set: nb total reaction=5}}
-{{#set: molecular-weight=165.154}}