Difference between revisions of "PWY-6754"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GAMMA-GLUTAMYLCYSTEINE L-GAMMA-GLUTAMYLCYSTEINE] == * common-name: ** γ-l-glutamyl-l-cy...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Leader-Sequences Leader-Sequences] == * common-name: ** a leader sequence == Reaction(s) known...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GAMMA-GLUTAMYLCYSTEINE L-GAMMA-GLUTAMYLCYSTEINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Leader-Sequences Leader-Sequences] ==
 
* common-name:
 
* common-name:
** γ-l-glutamyl-l-cysteine
+
** a leader sequence
* smiles:
 
** c(s)c(c([o-])=o)nc(=o)ccc([n+])c([o-])=o
 
* inchi-key:
 
** ritkhvbhsgluln-whfbiakzsa-m
 
* molecular-weight:
 
** 249.261
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUTATHIONE-SYN-RXN]]
 
* [[RXN-14430]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLUTCYSLIG-RXN]]
+
* [[3.4.21.89-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=γ-l-glutamyl-l-cysteine}}
+
{{#set: common-name=a leader sequence}}
{{#set: inchi-key=inchikey=ritkhvbhsgluln-whfbiakzsa-m}}
 
{{#set: molecular-weight=249.261}}
 

Revision as of 14:18, 26 August 2019

Metabolite Leader-Sequences

  • common-name:
    • a leader sequence

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality