Difference between revisions of "PWY-6759"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE 2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE] == * common-name: ** p...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-Gal-NAc--Glycoproteins D-Gal-NAc--Glycoproteins] == * common-name: ** an n-acetyl-α-d-g...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE 2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-Gal-NAc--Glycoproteins D-Gal-NAc--Glycoproteins] ==
 
* common-name:
 
* common-name:
** phylloquinone
+
** an n-acetyl-α-d-galactosalaminyl-[glycoprotein]
* smiles:
 
** cc(c)cccc(c)cccc(c)cccc(c)=ccc2(=c(c(=o)c1(c=cc=cc=1c2=o))c)
 
* inchi-key:
 
** mbwxntaxlnyfjb-lkudqcmesa-n
 
* molecular-weight:
 
** 450.703
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.4.1-RXN]]
+
* [[2.4.1.122-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.4.1-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phylloquinone}}
+
{{#set: common-name=an n-acetyl-α-d-galactosalaminyl-[glycoprotein]}}
{{#set: inchi-key=inchikey=mbwxntaxlnyfjb-lkudqcmesa-n}}
 
{{#set: molecular-weight=450.703}}
 

Revision as of 14:18, 26 August 2019

Metabolite D-Gal-NAc--Glycoproteins

  • common-name:
    • an n-acetyl-α-d-galactosalaminyl-[glycoprotein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-acetyl-α-d-galactosalaminyl-[glycoprotein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.