Difference between revisions of "PWY-6763"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N1-Methylguanine-37 tRNA-Containing-N1-Methylguanine-37] == * common-name: ** a...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-ENOLPYRUVYL-SHIKIMATE-5P 3-ENOLPYRUVYL-SHIKIMATE-5P] == * common-name: ** 5-enolpyruvoyl-shik...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N1-Methylguanine-37 tRNA-Containing-N1-Methylguanine-37] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-ENOLPYRUVYL-SHIKIMATE-5P 3-ENOLPYRUVYL-SHIKIMATE-5P] ==
 
* common-name:
 
* common-name:
** an n1-methylguanine37 in trna
+
** 5-enolpyruvoyl-shikimate 3-phosphate
 +
* smiles:
 +
** c=c(c(=o)[o-])oc1(cc(c(=o)[o-])=cc(op(=o)([o-])[o-])c(o)1)
 +
* inchi-key:
 +
** qutykixiudqolk-prjmdxoysa-j
 +
* molecular-weight:
 +
** 320.149
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.5.1.19-RXN]]
 +
* [[CHORISMATE-SYNTHASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12458]]
+
* [[2.5.1.19-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n1-methylguanine37 in trna}}
+
{{#set: common-name=5-enolpyruvoyl-shikimate 3-phosphate}}
 +
{{#set: inchi-key=inchikey=qutykixiudqolk-prjmdxoysa-j}}
 +
{{#set: molecular-weight=320.149}}

Revision as of 09:22, 27 August 2019

Metabolite 3-ENOLPYRUVYL-SHIKIMATE-5P

  • common-name:
    • 5-enolpyruvoyl-shikimate 3-phosphate
  • smiles:
    • c=c(c(=o)[o-])oc1(cc(c(=o)[o-])=cc(op(=o)([o-])[o-])c(o)1)
  • inchi-key:
    • qutykixiudqolk-prjmdxoysa-j
  • molecular-weight:
    • 320.149

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality