Difference between revisions of "PWY-6773"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARACHIDIC_ACID ARACHIDIC_ACID] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYL-PP GERANYL-PP] ==
 * common-name:
-** arachidate
+** geranyl diphosphate
 * smiles:
-** cccccccccccccccccccc(=o)[o-]
+** cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c
 * inchi-key:
-** vkobvwxkncxxde-uhfffaoysa-m
+** gvvpgtzrzfnkds-jxmrogbwsa-k
 * molecular-weight:
-** 311.527
+** 311.188
 == Reaction(s) known to consume the compound ==
+* [[FPPS]]
+* [[FPPSYN-RXN]]
+* [[GPPSYN-RXN]]
+* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-9629]]
+* [[GPPS]]
+* [[GPPSYN-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=arachidate}}
+{{#set: common-name=geranyl diphosphate}}
-{{#set: inchi-key=inchikey=vkobvwxkncxxde-uhfffaoysa-m}}
+{{#set: inchi-key=inchikey=gvvpgtzrzfnkds-jxmrogbwsa-k}}
-{{#set: molecular-weight=311.527}}
+{{#set: molecular-weight=311.188}}