Difference between revisions of "PWY-6773"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARACHIDIC_ACID ARACHIDIC_ACID] == * common-name: ** arachidate * smiles: ** ccccccccccccccccccc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYL-PP GERANYL-PP] == * common-name: ** geranyl diphosphate * smiles: ** cc(=cccc(=ccop([o-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYL-PP GERANYL-PP] == |
* common-name: | * common-name: | ||
− | ** | + | ** geranyl diphosphate |
* smiles: | * smiles: | ||
− | ** | + | ** cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** gvvpgtzrzfnkds-jxmrogbwsa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** 311. | + | ** 311.188 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[FPPS]] | ||
+ | * [[FPPSYN-RXN]] | ||
+ | * [[GPPSYN-RXN]] | ||
+ | * [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[GPPS]] |
+ | * [[GPPSYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=geranyl diphosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gvvpgtzrzfnkds-jxmrogbwsa-k}} |
− | {{#set: molecular-weight=311. | + | {{#set: molecular-weight=311.188}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite GERANYL-PP
- common-name:
- geranyl diphosphate
- smiles:
- cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c
- inchi-key:
- gvvpgtzrzfnkds-jxmrogbwsa-k
- molecular-weight:
- 311.188