Difference between revisions of "PWY-6773"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYL-PP GERANYL-PP] ==
+== Pathway PWY-5409 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** geranyl diphosphate
+** divinyl ether biosynthesis ii
-* smiles:
+== Reaction(s) found ==
-** cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c
+* [[LIPOXYGENASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** gvvpgtzrzfnkds-jxmrogbwsa-k
+* [NoneRXN-8504 RXN-8504]
-* molecular-weight:
+{{#set: taxonomic-range=tax-33090}}
-** 311.188
+{{#set: common-name=divinyl ether biosynthesis ii}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[FPPS]]
+{{#set: completion rate=0.5}}
-* [[FPPSYN-RXN]]
+{{#set: nb total reaction=2}}
-* [[GPPSYN-RXN]]
-* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
-== Reaction(s) known to produce the compound ==
-* [[GPPS]]
-* [[GPPSYN-RXN]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=geranyl diphosphate}}
-{{#set: inchi-key=inchikey=gvvpgtzrzfnkds-jxmrogbwsa-k}}
-{{#set: molecular-weight=311.188}}