Difference between revisions of "PWY-6784"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8089 CPD-8089] ==
+== Pathway PWY-5381 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** 1-&alpha;-linolenoyl-2-oleoyl-phosphatidylcholine
+** pyridine nucleotide cycling (plants)
-* smiles:
+== Reaction(s) found ==
-** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
+* [[NAD-SYNTH-GLN-RXN]]
-* inchi-key:
+* [[NADPYROPHOSPHAT-RXN]]
-** lpdgucimnbnwej-bxzvqshesa-n
+* [[NICONUCADENYLYLTRAN-RXN]]
-* molecular-weight:
+* [[NICOTINATEPRIBOSYLTRANS-RXN]]
-** 782.092
+* [[RXN-5841]]
-== Reaction(s) known to consume the compound ==
+* [[RXN-8443]]
-* [[RXN-8330]]
+== Reaction(s) not found ==
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-8442 RXN-8442]
-* [[RXN-8321]]
+* [NoneRXN-8444 RXN-8444]
-== Reaction(s) of unknown directionality ==
+* [NoneNICOTINAMID-RXN NICOTINAMID-RXN]
-{{#set: common-name=1-&alpha;-linolenoyl-2-oleoyl-phosphatidylcholine}}
+* [NoneNMNNUCLEOSID-RXN NMNNUCLEOSID-RXN]
-{{#set: inchi-key=inchikey=lpdgucimnbnwej-bxzvqshesa-n}}
+* [NoneRXN-8441 RXN-8441]
-{{#set: molecular-weight=782.092}}
+{{#set: taxonomic-range=tax-33090}}
+{{#set: common-name=pyridine nucleotide cycling (plants)}}
+{{#set: nb reaction found=6}}
+{{#set: completion rate=0.55}}
+{{#set: nb total reaction=11}}