Difference between revisions of "PWY-6787"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13406 CPD-13406] ==
+== Pathway PWY-6787 ==
+* taxonomic-range:
+** tax-33090
+** tax-3257
 * common-name:
-** glycyl-l-aspartate
+** flavonoid biosynthesis (in equisetum)
-* smiles:
+== Reaction(s) found ==
-** c([n+])c(=o)nc(cc(=o)[o-])c(=o)[o-]
+* [[APIGNAR-RXN]]
-* inchi-key:
+* [[NARINGENIN-3-DIOXYGENASE-RXN]]
-** sccpdjaqcxwptf-vkhmyheasa-m
+* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
-* molecular-weight:
+* [[RXN-527]]
-** 189.147
+* [[RXN-7775]]
-== Reaction(s) known to consume the compound ==
+* [[RXN1F-93]]
-* [[RXN0-6987]]
+== Reaction(s) not found ==
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-7652 RXN-7652]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-7687 RXN-7687]
-{{#set: common-name=glycyl-l-aspartate}}
+* [NoneRXN-7686 RXN-7686]
-{{#set: inchi-key=inchikey=sccpdjaqcxwptf-vkhmyheasa-m}}
+* [NoneRXN-7921 RXN-7921]
-{{#set: molecular-weight=189.147}}
+{{#set: taxonomic-range=tax-3257|tax-33090}}
+{{#set: common-name=flavonoid biosynthesis (in equisetum)}}
+{{#set: nb reaction found=6}}
+{{#set: completion rate=0.6}}
+{{#set: nb total reaction=10}}