Difference between revisions of "PWY-6787"

Revision as of 20:15, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13406 CPD-13406] ==
+== Pathway GLUT-REDOX-PWY ==
+* taxonomic-range:
+** tax-2759
+** tax-2
 * common-name:
-** glycyl-l-aspartate
+** glutathione-glutaredoxin redox reactions
-* smiles:
+== Reaction(s) found ==
-** c([n+])c(=o)nc(cc(=o)[o-])c(=o)[o-]
+* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** sccpdjaqcxwptf-vkhmyheasa-m
+* [NoneRXN0-7271 RXN0-7271]
-* molecular-weight:
+* [NonePRODISULFREDUCT-A-RXN PRODISULFREDUCT-A-RXN]
-** 189.147
+{{#set: taxonomic-range=tax-2|tax-2759}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=glutathione-glutaredoxin redox reactions}}
-* [[RXN0-6987]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.5}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=2}}
-{{#set: common-name=glycyl-l-aspartate}}
-{{#set: inchi-key=inchikey=sccpdjaqcxwptf-vkhmyheasa-m}}
-{{#set: molecular-weight=189.147}}