Difference between revisions of "PWY-6799"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOVALERYL-COA ISOVALERYL-COA] ==
+== Pathway PWY-6799 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** isovaleryl-coa
+** fatty acid biosynthesis (plant mitochondria)
-* smiles:
+== Reaction(s) found ==
-** cc(cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
+* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** uyvziwwbjmyrcd-zmhdxicwsa-j
+* [NoneRXN-12359 RXN-12359]
-* molecular-weight:
+* [NoneRXN-12361 RXN-12361]
-** 847.62
+* [NoneRXN-12360 RXN-12360]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-33090}}
-* [[ISOVALERYLCOA-DHLIPOAMIDE-RXN]]
+{{#set: common-name=fatty acid biosynthesis (plant mitochondria)}}
-* [[IVCDH]]
+{{#set: nb reaction found=1}}
-* [[RXN-14264]]
+{{#set: completion rate=0.25}}
-* [[RXN0-2301]]
+{{#set: nb total reaction=4}}
-== Reaction(s) known to produce the compound ==
-* [[RXN-14264]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=isovaleryl-coa}}
-{{#set: inchi-key=inchikey=uyvziwwbjmyrcd-zmhdxicwsa-j}}
-{{#set: molecular-weight=847.62}}