Difference between revisions of "PWY-6799"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHOSINE XANTHOSINE] == * common-name: ** xanthosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VibB VibB] == * common-name: ** an apo-[vibb aryl-carrier protein] == Reaction(s) known to cons...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHOSINE XANTHOSINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VibB VibB] ==
 
* common-name:
 
* common-name:
** xanthosine
+
** an apo-[vibb aryl-carrier protein]
* smiles:
 
** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23)))
 
* inchi-key:
 
** ubortcndukbeop-uuokfmhzsa-n
 
* molecular-weight:
 
** 284.228
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-363]]
+
* [[RXN-10994]]
* [[XANTHOSINEPHOSPHORY-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[X5NT]]
+
* [[RXN-10994]]
* [[XMPXAN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=xanthosine}}
+
{{#set: common-name=an apo-[vibb aryl-carrier protein]}}
{{#set: inchi-key=inchikey=ubortcndukbeop-uuokfmhzsa-n}}
 
{{#set: molecular-weight=284.228}}
 

Revision as of 09:22, 27 August 2019

Metabolite VibB

  • common-name:
    • an apo-[vibb aryl-carrier protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an apo-[vibb aryl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.