Difference between revisions of "PWY-6807"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] ==
+== Pathway PWY-6807 ==
+* taxonomic-range:
+** tax-4751
 * common-name:
-** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
+** xyloglucan degradation ii (exoglucanase)
-* smiles:
+== Reaction(s) found ==
-** cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op(=o)([o-])[o-])c
+* [[RXN-12398]]
-* inchi-key:
+* [[RXN-12399]]
-** oinneunvozhbox-kwbdajkesa-k
+* [[RXN-12400]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 447.424
+* [NoneRXN-12401 RXN-12401]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-12402 RXN-12402]
-== Reaction(s) known to produce the compound ==
+* [None3.2.1.120-RXN 3.2.1.120-RXN]
-* [[RXN0-5180]]
+* [NoneRXN-19378 RXN-19378]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-19379 RXN-19379]
-{{#set: common-name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}}
+{{#set: taxonomic-range=tax-4751}}
-{{#set: inchi-key=inchikey=oinneunvozhbox-kwbdajkesa-k}}
+{{#set: common-name=xyloglucan degradation ii (exoglucanase)}}
-{{#set: molecular-weight=447.424}}
+{{#set: nb reaction found=3}}
+{{#set: completion rate=0.38}}
+{{#set: nb total reaction=8}}