Difference between revisions of "PWY-6807"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-41 CPDQT-41] == * common-name: ** 10-(methylthio)-2-oxodecanoate * smiles: ** csccccccccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] == * common-name: ** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate * s...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-41 CPDQT-41] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] ==
 
* common-name:
 
* common-name:
** 10-(methylthio)-2-oxodecanoate
+
** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
 
* smiles:
 
* smiles:
** csccccccccc(=o)c([o-])=o
+
** cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op(=o)([o-])[o-])c
 
* inchi-key:
 
* inchi-key:
** iezwlijbcdcgeu-uhfffaoysa-m
+
** oinneunvozhbox-kwbdajkesa-k
 
* molecular-weight:
 
* molecular-weight:
** 231.329
+
** 447.424
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXNQT-4178]]
+
* [[RXN0-5180]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=10-(methylthio)-2-oxodecanoate}}
+
{{#set: common-name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}}
{{#set: inchi-key=inchikey=iezwlijbcdcgeu-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=oinneunvozhbox-kwbdajkesa-k}}
{{#set: molecular-weight=231.329}}
+
{{#set: molecular-weight=447.424}}

Revision as of 14:19, 26 August 2019

Metabolite CPD0-1028

  • common-name:
    • 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
  • smiles:
    • cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op(=o)([o-])[o-])c
  • inchi-key:
    • oinneunvozhbox-kwbdajkesa-k
  • molecular-weight:
    • 447.424

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality