Difference between revisions of "PWY-6807"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] ==
+== Pathway PWY-7892 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
+** trna-uridine 2-thiolation (bacteria)
-* smiles:
+== Reaction(s) found ==
-** cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op(=o)([o-])[o-])c
+* [[RXN0-2023]]
-* inchi-key:
+* [[RXN0-308]]
-** oinneunvozhbox-kwbdajkesa-k
+* [[RXN0-5144]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 447.424
+* [NoneRXN-18707 RXN-18707]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-18708 RXN-18708]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-20756 RXN-20756]
-* [[RXN0-5180]]
+* [NoneRXN-18710 RXN-18710]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-20757 RXN-20757]
-{{#set: common-name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}}
+* [NoneRXN0-7081 RXN0-7081]
-{{#set: inchi-key=inchikey=oinneunvozhbox-kwbdajkesa-k}}
+* [NoneRXN-18709 RXN-18709]
-{{#set: molecular-weight=447.424}}
+* [NoneRXN-20755 RXN-20755]
+{{#set: taxonomic-range=tax-2}}
+{{#set: common-name=trna-uridine 2-thiolation (bacteria)}}
+{{#set: nb reaction found=3}}
+{{#set: completion rate=0.27}}
+{{#set: nb total reaction=11}}