Difference between revisions of "PWY-6808"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8973 CPD-8973] == * common-name: ** methyl parathion * smiles: ** cop(oc1(=cc=c(c=c1)[n+](=...")
(Created page with "Category:pathway == Pathway PWY-6808 == * taxonomic-range: ** tax-201174 * common-name: ** dtdp-d-forosamine biosynthesis == Reaction(s) found == * [[DTDPGLUCDEHYDRAT-RXN]...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8973 CPD-8973] ==
+
== Pathway PWY-6808 ==
 +
* taxonomic-range:
 +
** tax-201174
 
* common-name:
 
* common-name:
** methyl parathion
+
** dtdp-d-forosamine biosynthesis
* smiles:
+
== Reaction(s) found ==
** cop(oc1(=cc=c(c=c1)[n+](=o)[o-]))(oc)=s
+
* [[DTDPGLUCDEHYDRAT-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** rlbiqvvomopohc-uhfffaoysa-n
+
* [NoneRXN-12404 RXN-12404]
* molecular-weight:
+
* [NoneRXN-12409 RXN-12409]
** 263.204
+
* [NoneRXN-16262 RXN-16262]
== Reaction(s) known to consume the compound ==
+
* [NoneDTDPGLUCOSEPP-RXN DTDPGLUCOSEPP-RXN]
* [[RXN-8743]]
+
* [NoneRXN-12408 RXN-12408]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-12943 RXN-12943]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN-12407 RXN-12407]
{{#set: common-name=methyl parathion}}
+
* [NoneRXN-12406 RXN-12406]
{{#set: inchi-key=inchikey=rlbiqvvomopohc-uhfffaoysa-n}}
+
{{#set: taxonomic-range=tax-201174}}
{{#set: molecular-weight=263.204}}
+
{{#set: common-name=dtdp-d-forosamine biosynthesis}}
 +
{{#set: nb reaction found=1}}
 +
{{#set: completion rate=0.11}}
 +
{{#set: nb total reaction=9}}

Latest revision as of 10:59, 18 March 2021

Pathway PWY-6808

  • taxonomic-range:
    • tax-201174
  • common-name:
    • dtdp-d-forosamine biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-12404 RXN-12404]
  • [NoneRXN-12409 RXN-12409]
  • [NoneRXN-16262 RXN-16262]
  • [NoneDTDPGLUCOSEPP-RXN DTDPGLUCOSEPP-RXN]
  • [NoneRXN-12408 RXN-12408]
  • [NoneRXN-12943 RXN-12943]
  • [NoneRXN-12407 RXN-12407]
  • [NoneRXN-12406 RXN-12406]