Difference between revisions of "PWY-6808"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8973 CPD-8973] ==
+== Pathway PWY-7821 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** methyl parathion
+** tunicamycin biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cop(oc1(=cc=c(c=c1)[n+](=o)[o-]))(oc)=s
+* [[RXN-14025]]
-* inchi-key:
+* [[RXN-14139]]
-** rlbiqvvomopohc-uhfffaoysa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-18069 RXN-18069]
-** 263.204
+* [NoneRXN-18070 RXN-18070]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-18068 RXN-18068]
-* [[RXN-8743]]
+* [NoneRXN-18074 RXN-18074]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-18072 RXN-18072]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-18071 RXN-18071]
-{{#set: common-name=methyl parathion}}
+* [NoneRXN-18073 RXN-18073]
-{{#set: inchi-key=inchikey=rlbiqvvomopohc-uhfffaoysa-n}}
+{{#set: taxonomic-range=tax-2}}
-{{#set: molecular-weight=263.204}}
+{{#set: common-name=tunicamycin biosynthesis}}
+{{#set: nb reaction found=2}}
+{{#set: completion rate=0.22}}
+{{#set: nb total reaction=9}}