Difference between revisions of "PWY-6809"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9663 CPD-9663] == * common-name: ** 2-epi-5-epi-valiolone * smiles: ** c(o)c1(o)(c(o)c(o)c(...")
 
(Created page with "Category:pathway == Pathway PWY-6809 == * taxonomic-range: ** tax-33090 * common-name: ** neoxanthin biosynthesis == Reaction(s) found == * RXN-8074 * RXN1F-155 ==...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9663 CPD-9663] ==
+
== Pathway PWY-6809 ==
 +
* taxonomic-range:
 +
** tax-33090
 
* common-name:
 
* common-name:
** 2-epi-5-epi-valiolone
+
** neoxanthin biosynthesis
* smiles:
+
== Reaction(s) found ==
** c(o)c1(o)(c(o)c(o)c(o)c(=o)c1)
+
* [[RXN-8074]]
* inchi-key:
+
* [[RXN1F-155]]
** jczfnxyqgnlhdq-mvioudgnsa-n
+
== Reaction(s) not found ==
* molecular-weight:
+
All reactions of this pathways are in present
** 192.168
+
{{#set: taxonomic-range=tax-33090}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=neoxanthin biosynthesis}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=2}}
* [[RXN-9140]]
+
{{#set: completion rate=1.0}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=2}}
{{#set: common-name=2-epi-5-epi-valiolone}}
 
{{#set: inchi-key=inchikey=jczfnxyqgnlhdq-mvioudgnsa-n}}
 
{{#set: molecular-weight=192.168}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY-6809

  • taxonomic-range:
    • tax-33090
  • common-name:
    • neoxanthin biosynthesis

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present