Difference between revisions of "PWY-6809"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9663 CPD-9663] == * common-name: ** 2-epi-5-epi-valiolone * smiles: ** c(o)c1(o)(c(o)c(o)c(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-guanine-2445 23S-rRNA-guanine-2445] == * common-name: ** a guanine2445 in 23s rrna ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9663 CPD-9663] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-guanine-2445 23S-rRNA-guanine-2445] ==
 
* common-name:
 
* common-name:
** 2-epi-5-epi-valiolone
+
** a guanine2445 in 23s rrna
* smiles:
 
** c(o)c1(o)(c(o)c(o)c(o)c(=o)c1)
 
* inchi-key:
 
** jczfnxyqgnlhdq-mvioudgnsa-n
 
* molecular-weight:
 
** 192.168
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11574]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9140]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-epi-5-epi-valiolone}}
+
{{#set: common-name=a guanine2445 in 23s rrna}}
{{#set: inchi-key=inchikey=jczfnxyqgnlhdq-mvioudgnsa-n}}
 
{{#set: molecular-weight=192.168}}
 

Revision as of 14:19, 26 August 2019

Metabolite 23S-rRNA-guanine-2445

  • common-name:
    • a guanine2445 in 23s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality