Difference between revisions of "PWY-6823"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-SER-tRNAs Charged-SER-tRNAs] == * common-name: ** an l-seryl-[trnaser] == Reaction(s) k...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE SQUALENE] == * common-name: ** squalene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc=c(c)cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE SQUALENE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** squalene |
| + | * smiles: | ||
| + | ** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c | ||
| + | * inchi-key: | ||
| + | ** yygntywphwgjrm-aajylucbsa-n | ||
| + | * molecular-weight: | ||
| + | ** 410.725 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[SMO]] | ||
| + | * [[SQUALENE-MONOOXYGENASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-13162]] |
| + | * [[RXN-13724]] | ||
| + | * [[RXN66-281]] | ||
| + | * [[SMO]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=squalene}} |
| + | {{#set: inchi-key=inchikey=yygntywphwgjrm-aajylucbsa-n}} | ||
| + | {{#set: molecular-weight=410.725}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite SQUALENE
- common-name:
- squalene
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c
- inchi-key:
- yygntywphwgjrm-aajylucbsa-n
- molecular-weight:
- 410.725
