Difference between revisions of "PWY-6825"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTAPRENYL-METHYL-OH-METHOXY-BENZQ OCTAPRENYL-METHYL-OH-METHOXY-BENZQ] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD3O-4151 CPD3O-4151] ==
 * common-name:
-** 3-demethylubiquinol-8
+** 4-tyrosol
 * smiles:
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1)
+** c1(c(=cc=c(c=1)o)cco)
 * inchi-key:
-** qurlimhpcrkmjp-wdxiliiosa-n
+** yccilvskpbxvip-uhfffaoysa-n
 * molecular-weight:
-** 715.11
+** 138.166
 == Reaction(s) known to consume the compound ==
-* [[DHHB-METHYLTRANSFER-RXN]]
 == Reaction(s) known to produce the compound ==
+* [[RXN3O-4113]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=3-demethylubiquinol-8}}
+{{#set: common-name=4-tyrosol}}
-{{#set: inchi-key=inchikey=qurlimhpcrkmjp-wdxiliiosa-n}}
+{{#set: inchi-key=inchikey=yccilvskpbxvip-uhfffaoysa-n}}
-{{#set: molecular-weight=715.11}}
+{{#set: molecular-weight=138.166}}