Difference between revisions of "PWY-6829"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13122 CPD-13122] == * common-name: ** 4-deoxy-l-threo-hex-4-enopyranuronate * smiles: ** c(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-fructosamines Protein-fructosamines] == * common-name: ** a [protein]-n6-d-fructosyl-l-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13122 CPD-13122] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-fructosamines Protein-fructosamines] ==
 
* common-name:
 
* common-name:
** 4-deoxy-l-threo-hex-4-enopyranuronate
+
** a [protein]-n6-d-fructosyl-l-lysine
* smiles:
 
** c(c1(oc(c(c(c=1)o)o)o))([o-])=o
 
* inchi-key:
 
** iakkjsvsfctlry-baktxgbysa-m
 
* molecular-weight:
 
** 175.118
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16512]]
+
* [[RXN-12005]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12177]]
 
* [[RXN-12178]]
 
* [[RXN-12270]]
 
* [[RXN-16485]]
 
* [[RXN-16512]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-deoxy-l-threo-hex-4-enopyranuronate}}
+
{{#set: common-name=a [protein]-n6-d-fructosyl-l-lysine}}
{{#set: inchi-key=inchikey=iakkjsvsfctlry-baktxgbysa-m}}
 
{{#set: molecular-weight=175.118}}
 

Revision as of 14:18, 26 August 2019

Metabolite Protein-fructosamines

  • common-name:
    • a [protein]-n6-d-fructosyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-n6-d-fructosyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.