Difference between revisions of "PWY-6845"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8052 CPD-8052] == * common-name: ** 1d-chiro-inositol * smiles: ** c1(c(c(c(c(c1o)o)o)o)o)o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] == * common-name: ** ppgpp * smiles: ** c(op(=o)([o-])op(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8052 CPD-8052] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] ==
 
* common-name:
 
* common-name:
** 1d-chiro-inositol
+
** ppgpp
 
* smiles:
 
* smiles:
** c1(c(c(c(c(c1o)o)o)o)o)o
+
** c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 
* inchi-key:
 
* inchi-key:
** cdaismweouebre-lkpkboigsa-n
+
** bufllcufnheseh-uuokfmhzsa-i
 
* molecular-weight:
 
* molecular-weight:
** 180.157
+
** 598.123
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14148]]
+
* [[GBDP]]
 +
* [[PPGPPSYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14148]]
+
* [[GBDP]]
 +
* [[GDPPYPHOSKIN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1d-chiro-inositol}}
+
{{#set: common-name=ppgpp}}
{{#set: inchi-key=inchikey=cdaismweouebre-lkpkboigsa-n}}
+
{{#set: inchi-key=inchikey=bufllcufnheseh-uuokfmhzsa-i}}
{{#set: molecular-weight=180.157}}
+
{{#set: molecular-weight=598.123}}

Revision as of 09:22, 27 August 2019

Metabolite GUANOSINE-5DP-3DP

  • common-name:
    • ppgpp
  • smiles:
    • c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • bufllcufnheseh-uuokfmhzsa-i
  • molecular-weight:
    • 598.123

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality