Difference between revisions of "PWY-6845"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] ==
+== Pathway PWY-7315 ==
+* taxonomic-range:
+** tax-1224
 * common-name:
-** ppgpp
+** dtdp-n-acetylthomosamine biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+* [[DTDPGLUCDEHYDRAT-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** bufllcufnheseh-uuokfmhzsa-i
+* [NoneRFFTRANS-RXN RFFTRANS-RXN]
-* molecular-weight:
+* [NoneTDPFUCACTRANS-RXN TDPFUCACTRANS-RXN]
-** 598.123
+* [NoneDTDPGLUCOSEPP-RXN DTDPGLUCOSEPP-RXN]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-1224}}
-* [[GBDP]]
+{{#set: common-name=dtdp-n-acetylthomosamine biosynthesis}}
-* [[PPGPPSYN-RXN]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.25}}
-* [[GBDP]]
+{{#set: nb total reaction=4}}
-* [[GDPPYPHOSKIN-RXN]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=ppgpp}}
-{{#set: inchi-key=inchikey=bufllcufnheseh-uuokfmhzsa-i}}
-{{#set: molecular-weight=598.123}}