Difference between revisions of "PWY-6854"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] == * common-name: ** l-cysteinyl-glycine * smiles: ** c(c([o-])=o)nc(c(cs)[n+]...")
 
(Created page with "Category:pathway == Pathway PWY-6854 == * taxonomic-range: ** tax-4751 ** tax-2 * common-name: ** ethylene biosynthesis iii (microbes) == Reaction(s) found == * FERRIC-C...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] ==
+
== Pathway PWY-6854 ==
 +
* taxonomic-range:
 +
** tax-4751
 +
** tax-2
 
* common-name:
 
* common-name:
** l-cysteinyl-glycine
+
** ethylene biosynthesis iii (microbes)
* smiles:
+
== Reaction(s) found ==
** c(c([o-])=o)nc(c(cs)[n+])=o
+
* [[FERRIC-CHELATE-REDUCTASE-RXN]]
* inchi-key:
+
* [[SUPEROX-DISMUT-RXN]]
** zukpvrwzdmrieo-vkhmyheasa-n
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneRXN-12541 RXN-12541]
** 178.206
+
* [NoneRXN-14960 RXN-14960]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-12539 RXN-12539]
* [[RXN-6622]]
+
* [NoneRXN-12540 RXN-12540]
== Reaction(s) known to produce the compound ==
+
* [NoneR15-RXN R15-RXN]
* [[RXN-12618]]
+
{{#set: taxonomic-range=tax-4751|tax-2}}
* [[RXN-18092]]
+
{{#set: common-name=ethylene biosynthesis iii (microbes)}}
* [[RXN-6601]]
+
{{#set: nb reaction found=2}}
* [[RXN-9157]]
+
{{#set: completion rate=0.29}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=7}}
{{#set: common-name=l-cysteinyl-glycine}}
 
{{#set: inchi-key=inchikey=zukpvrwzdmrieo-vkhmyheasa-n}}
 
{{#set: molecular-weight=178.206}}
 

Latest revision as of 10:57, 18 March 2021

Pathway PWY-6854

  • taxonomic-range:
    • tax-4751
    • tax-2
  • common-name:
    • ethylene biosynthesis iii (microbes)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-12541 RXN-12541]
  • [NoneRXN-14960 RXN-14960]
  • [NoneRXN-12539 RXN-12539]
  • [NoneRXN-12540 RXN-12540]
  • [NoneR15-RXN R15-RXN]