Difference between revisions of "PWY-6854"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] == * common-name: ** l-cysteinyl-glycine * smiles: ** c(c([o-])=o)nc(c(cs)[n+]...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cyclic-3-5-Nucleoside-Monophosphates Cyclic-3-5-Nucleoside-Monophosphates] == * common-name: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cyclic-3-5-Nucleoside-Monophosphates Cyclic-3-5-Nucleoside-Monophosphates] ==
 
* common-name:
 
* common-name:
** l-cysteinyl-glycine
+
** a nucleoside cyclic 3',5'-monophosphate
* smiles:
 
** c(c([o-])=o)nc(c(cs)[n+])=o
 
* inchi-key:
 
** zukpvrwzdmrieo-vkhmyheasa-n
 
* molecular-weight:
 
** 178.206
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-6622]]
+
* [[3.1.4.17-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12618]]
 
* [[RXN-18092]]
 
* [[RXN-6601]]
 
* [[RXN-9157]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-cysteinyl-glycine}}
+
{{#set: common-name=a nucleoside cyclic 3',5'-monophosphate}}
{{#set: inchi-key=inchikey=zukpvrwzdmrieo-vkhmyheasa-n}}
 
{{#set: molecular-weight=178.206}}
 

Revision as of 14:18, 26 August 2019

Metabolite Cyclic-3-5-Nucleoside-Monophosphates

  • common-name:
    • a nucleoside cyclic 3',5'-monophosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality