Difference between revisions of "PWY-6855"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SOLANESYL-PYROPHOSPHATE SOLANESYL-PYROPHOSPHATE] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Very-long-Chain-234-Saturated-acyl-CoAs Very-long-Chain-234-Saturated-acyl-CoAs] ==
 * common-name:
-** all-trans-nonaprenyl diphosphate
+** a very-long-chain 2,3,4-saturated fatty acyl coa
-* smiles:
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
-* inchi-key:
-** ivlbhbftrnviap-meggaxogsa-k
-* molecular-weight:
-** 788.015
 == Reaction(s) known to consume the compound ==
-* [[RXN-2761]]
+* [[RXN-7697]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-11486]]
-* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=all-trans-nonaprenyl diphosphate}}
+{{#set: common-name=a very-long-chain 2,3,4-saturated fatty acyl coa}}
-{{#set: inchi-key=inchikey=ivlbhbftrnviap-meggaxogsa-k}}
-{{#set: molecular-weight=788.015}}