Difference between revisions of "PWY-6859"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=18-HYDROXYOLEATE 18-HYDROXYOLEATE] == * common-name: ** 18-hydroxyoleate * smiles: ** c(o)ccccc...")
(Created page with "Category:pathway == Pathway PWY-6859 == * taxonomic-range: ** tax-2759 * common-name: ** all-trans-farnesol biosynthesis == Reaction(s) found == * FPPSYN-RXN * GPPSY...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=18-HYDROXYOLEATE 18-HYDROXYOLEATE] ==
+
== Pathway PWY-6859 ==
 +
* taxonomic-range:
 +
** tax-2759
 
* common-name:
 
* common-name:
** 18-hydroxyoleate
+
** all-trans-farnesol biosynthesis
* smiles:
+
== Reaction(s) found ==
** c(o)cccccccc=ccccccccc(=o)[o-]
+
* [[FPPSYN-RXN]]
* inchi-key:
+
* [[GPPSYN-RXN]]
** lquhzvlttwmbto-uphrsurjsa-m
+
* [[IPPISOM-RXN]]
* molecular-weight:
+
== Reaction(s) not found ==
** 297.457
+
* [NoneRXN-8617 RXN-8617]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-2759}}
* [[RXN-16402]]
+
{{#set: common-name=all-trans-farnesol biosynthesis}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=3}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.75}}
{{#set: common-name=18-hydroxyoleate}}
+
{{#set: nb total reaction=4}}
{{#set: inchi-key=inchikey=lquhzvlttwmbto-uphrsurjsa-m}}
 
{{#set: molecular-weight=297.457}}
 

Latest revision as of 11:00, 18 March 2021

Pathway PWY-6859

  • taxonomic-range:
    • tax-2759
  • common-name:
    • all-trans-farnesol biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-8617 RXN-8617]