Difference between revisions of "PWY-6859"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=18-HYDROXYOLEATE 18-HYDROXYOLEATE] == * common-name: ** 18-hydroxyoleate * smiles: ** c(o)ccccc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N1-MethylAdenine-58 tRNA-Containing-N1-MethylAdenine-58] == * common-name: ** a...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=18-HYDROXYOLEATE 18-HYDROXYOLEATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N1-MethylAdenine-58 tRNA-Containing-N1-MethylAdenine-58] ==
 
* common-name:
 
* common-name:
** 18-hydroxyoleate
+
** an n1-methyladenine58 in trna
* smiles:
 
** c(o)cccccccc=ccccccccc(=o)[o-]
 
* inchi-key:
 
** lquhzvlttwmbto-uphrsurjsa-m
 
* molecular-weight:
 
** 297.457
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16402]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12466]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=18-hydroxyoleate}}
+
{{#set: common-name=an n1-methyladenine58 in trna}}
{{#set: inchi-key=inchikey=lquhzvlttwmbto-uphrsurjsa-m}}
 
{{#set: molecular-weight=297.457}}
 

Revision as of 09:23, 27 August 2019

Metabolite tRNA-Containing-N1-MethylAdenine-58

  • common-name:
    • an n1-methyladenine58 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality